C33H34F3N5O5 — CID 66558885
(7R)-7-[[4-[(3R)-3-methyl-4-[[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]methyl]piperazin-1-yl]phenoxy]methyl]-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine (PubChem CID 66558885) has the molecular formula C33H34F3N5O5 and a molecular weight of 637.66 g/mol. Its IUPAC name is (7R)-7-[[4-[(3R)-3-methyl-4-[[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]methyl]piperazin-1-yl]phenoxy]methyl]-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine.
| Compound Name | (7R)-7-[[4-[(3R)-3-methyl-4-[[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]methyl]piperazin-1-yl]phenoxy]methyl]-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine |
|---|---|
| PubChem CID | 66558885 |
| Molecular Formula | C33H34F3N5O5 |
| Molecular Weight | 637.66 g/mol |
| Exact Mass | 637.25 |
| IUPAC Name | (7R)-7-[[4-[(3R)-3-methyl-4-[[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]methyl]piperazin-1-yl]phenoxy]methyl]-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine |
| SMILES | C[C@@H]1CN(c2ccc(OC[C@H]3CCn4cc([N+](=O)[O-])nc4O3)cc2)CCN1Cc1ccc(OCc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C33H34F3N5O5/c1-23-18-39(27-8-12-29(13-9-27)45-22-30-14-15-40-20-31(41(42)43)37-32(40)46-30)17-16-38(23)19-24-4-10-28(11-5-24)44-21-25-2-6-26(7-3-25)33(34,35)36/h2-13,20,23,30H,14-19,21-22H2,1H3/t23-,30-/m1/s1 |
| InChIKey | KWPFAJJLPVFSAP-WVXBCFDCSA-N |
| XLogP | 6.33 |
| TPSA | 95.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.66 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|