About 4-(oxolan-3-ylmethyl)-[1,3]oxazolo[4,5-b]pyridin-2-one
4-(oxolan-3-ylmethyl)-[1,3]oxazolo[4,5-b]pyridin-2-one (PubChem CID 66559053) has the molecular formula C11H12N2O3
and a molecular weight of 220.23 g/mol. Its IUPAC name is 4-(oxolan-3-ylmethyl)-[1,3]oxazolo[4,5-b]pyridin-2-one.
Molecular Properties
| Compound Name | 4-(oxolan-3-ylmethyl)-[1,3]oxazolo[4,5-b]pyridin-2-one |
| PubChem CID | 66559053 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 4-(oxolan-3-ylmethyl)-[1,3]oxazolo[4,5-b]pyridin-2-one |
| SMILES | O=c1nc2n(CC3CCOC3)cccc-2o1 |
| InChI | InChI=1S/C11H12N2O3/c14-11-12-10-9(16-11)2-1-4-13(10)6-8-3-5-15-7-8/h1-2,4,8H,3,5-7H2 |
| InChIKey | AAHDAJMTJKVCSR-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 57.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(oxolan-3-ylmethyl)-[1,3]oxazolo[4,5-b]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(oxolan-3-ylmethyl)-[1,3]oxazolo[4,5-b]pyridin-2-one?
The IUPAC name of 4-(oxolan-3-ylmethyl)-[1,3]oxazolo[4,5-b]pyridin-2-one (CID 66559053) is 4-(oxolan-3-ylmethyl)-[1,3]oxazolo[4,5-b]pyridin-2-one.
What is the SMILES notation for 4-(oxolan-3-ylmethyl)-[1,3]oxazolo[4,5-b]pyridin-2-one?
The canonical SMILES for 4-(oxolan-3-ylmethyl)-[1,3]oxazolo[4,5-b]pyridin-2-one is O=c1nc2n(CC3CCOC3)cccc-2o1.
What is the InChIKey of 4-(oxolan-3-ylmethyl)-[1,3]oxazolo[4,5-b]pyridin-2-one?
The InChIKey is AAHDAJMTJKVCSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O3/c14-11-12-10-9(16-11)2-1-4-13(10)6-8-3-5-15-7-8/h1-2,4,8H,3,5-7H2.
What are the key properties of 4-(oxolan-3-ylmethyl)-[1,3]oxazolo[4,5-b]pyridin-2-one?
4-(oxolan-3-ylmethyl)-[1,3]oxazolo[4,5-b]pyridin-2-one has a molecular weight of 220.23 g/mol, XLogP of 0.98, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(oxolan-3-ylmethyl)-[1,3]oxazolo[4,5-b]pyridin-2-one is sourced from PubChem (CID 66559053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).