C20H19F5N4O3 — CID 66559099
N-[3-[(4R,5R)-2-amino-5-fluoro-4,5-dimethyl-6H-1,3-oxazin-4-yl]-4-fluorophenyl]-3-(2,2,2-trifluoroethoxy)pyridine-2-carboxamide (PubChem CID 66559099) has the molecular formula C20H19F5N4O3 and a molecular weight of 458.39 g/mol. Its IUPAC name is N-[3-[(4R,5R)-2-amino-5-fluoro-4,5-dimethyl-6H-1,3-oxazin-4-yl]-4-fluorophenyl]-3-(2,2,2-trifluoroethoxy)pyridine-2-carboxamide.
| Compound Name | N-[3-[(4R,5R)-2-amino-5-fluoro-4,5-dimethyl-6H-1,3-oxazin-4-yl]-4-fluorophenyl]-3-(2,2,2-trifluoroethoxy)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 66559099 |
| Molecular Formula | C20H19F5N4O3 |
| Molecular Weight | 458.39 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | N-[3-[(4R,5R)-2-amino-5-fluoro-4,5-dimethyl-6H-1,3-oxazin-4-yl]-4-fluorophenyl]-3-(2,2,2-trifluoroethoxy)pyridine-2-carboxamide |
| SMILES | C[C@]1(F)COC(N)=N[C@]1(C)c1cc(NC(=O)c2ncccc2OCC(F)(F)F)ccc1F |
| InChI | InChI=1S/C20H19F5N4O3/c1-18(22)9-32-17(26)29-19(18,2)12-8-11(5-6-13(12)21)28-16(30)15-14(4-3-7-27-15)31-10-20(23,24)25/h3-8H,9-10H2,1-2H3,(H2,26,29)(H,28,30)/t18-,19+/m0/s1 |
| InChIKey | WAGVRKPPJOWFFS-RBUKOAKNSA-N |
| XLogP | 3.70 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.39 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |