C10H10ClN3OS2 — CID 66559138
4-[(2-chloro-1,3-thiazol-5-yl)methyl]-5,6,7,7a-tetrahydro-[1,3]oxazolo[4,5-b]pyridine-2-thione (PubChem CID 66559138) has the molecular formula C10H10ClN3OS2 and a molecular weight of 287.80 g/mol. Its IUPAC name is 4-[(2-chloro-1,3-thiazol-5-yl)methyl]-5,6,7,7a-tetrahydro-[1,3]oxazolo[4,5-b]pyridine-2-thione.
| Compound Name | 4-[(2-chloro-1,3-thiazol-5-yl)methyl]-5,6,7,7a-tetrahydro-[1,3]oxazolo[4,5-b]pyridine-2-thione |
|---|---|
| PubChem CID | 66559138 |
| Molecular Formula | C10H10ClN3OS2 |
| Molecular Weight | 287.80 g/mol |
| Exact Mass | 287.00 |
| IUPAC Name | 4-[(2-chloro-1,3-thiazol-5-yl)methyl]-5,6,7,7a-tetrahydro-[1,3]oxazolo[4,5-b]pyridine-2-thione |
| SMILES | S=C1N=C2C(CCCN2Cc2cnc(Cl)s2)O1 |
| InChI | InChI=1S/C10H10ClN3OS2/c11-9-12-4-6(17-9)5-14-3-1-2-7-8(14)13-10(16)15-7/h4,7H,1-3,5H2 |
| InChIKey | IPXJGUIGHQFKGO-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 37.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.80 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|