C28H32N2 — CID 66559392
4-[(Z)-[(1S,3aS,7aS)-1-isoquinolin-7-yl-7a-methyl-2,3,3a,4,6,7-hexahydro-1H-inden-5-ylidene]methyl]-N,N-dimethylaniline (PubChem CID 66559392) has the molecular formula C28H32N2 and a molecular weight of 396.58 g/mol. Its IUPAC name is 4-[(Z)-[(1S,3aS,7aS)-1-isoquinolin-7-yl-7a-methyl-2,3,3a,4,6,7-hexahydro-1H-inden-5-ylidene]methyl]-N,N-dimethylaniline.
| Compound Name | 4-[(Z)-[(1S,3aS,7aS)-1-isoquinolin-7-yl-7a-methyl-2,3,3a,4,6,7-hexahydro-1H-inden-5-ylidene]methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 66559392 |
| Molecular Formula | C28H32N2 |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.26 |
| IUPAC Name | 4-[(Z)-[(1S,3aS,7aS)-1-isoquinolin-7-yl-7a-methyl-2,3,3a,4,6,7-hexahydro-1H-inden-5-ylidene]methyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/C=C2/CC[C@@]3(C)[C@@H](CC[C@@H]3c3ccc4ccncc4c3)C2)cc1 |
| InChI | InChI=1S/C28H32N2/c1-28-14-12-21(16-20-4-9-26(10-5-20)30(2)3)17-25(28)8-11-27(28)23-7-6-22-13-15-29-19-24(22)18-23/h4-7,9-10,13,15-16,18-19,25,27H,8,11-12,14,17H2,1-3H3/b21-16-/t25-,27+,28-/m0/s1 |
| InChIKey | RJCWTZDREAFWPD-XDUOHMMSSA-N |
| XLogP | 7.07 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|