C28H32N8O2S2 — CID 66559500
N-[[(2R)-1-[4-(but-3-enylamino)-6-[(2-phenyl-1,3-thiazol-4-yl)methylamino]-1,3,5-triazin-2-yl]pyrrolidin-2-yl]methyl]benzenesulfonamide (PubChem CID 66559500) has the molecular formula C28H32N8O2S2 and a molecular weight of 576.75 g/mol. Its IUPAC name is N-[[(2R)-1-[4-(but-3-enylamino)-6-[(2-phenyl-1,3-thiazol-4-yl)methylamino]-1,3,5-triazin-2-yl]pyrrolidin-2-yl]methyl]benzenesulfonamide.
| Compound Name | N-[[(2R)-1-[4-(but-3-enylamino)-6-[(2-phenyl-1,3-thiazol-4-yl)methylamino]-1,3,5-triazin-2-yl]pyrrolidin-2-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 66559500 |
| Molecular Formula | C28H32N8O2S2 |
| Molecular Weight | 576.75 g/mol |
| Exact Mass | 576.21 |
| IUPAC Name | N-[[(2R)-1-[4-(but-3-enylamino)-6-[(2-phenyl-1,3-thiazol-4-yl)methylamino]-1,3,5-triazin-2-yl]pyrrolidin-2-yl]methyl]benzenesulfonamide |
| SMILES | C=CCCNc1nc(NCc2csc(-c3ccccc3)n2)nc(N2CCC[C@@H]2CNS(=O)(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C28H32N8O2S2/c1-2-3-16-29-26-33-27(30-18-22-20-39-25(32-22)21-11-6-4-7-12-21)35-28(34-26)36-17-10-13-23(36)19-31-40(37,38)24-14-8-5-9-15-24/h2,4-9,11-12,14-15,20,23,31H,1,3,10,13,16-19H2,(H2,29,30,33,34,35)/t23-/m1/s1 |
| InChIKey | SZDHHWFNRUURDS-HSZRJFAPSA-N |
| XLogP | 4.54 |
| TPSA | 125.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.75 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|