C14H18O3 — CID 66559538
(3'S,4R,4aS)-3'-hydroxy-1'-methylspiro[1,3,4a,5-tetrahydrocyclopenta[c]pyran-4,4'-cyclohexene]-6-one (PubChem CID 66559538) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is (3'S,4R,4aS)-3'-hydroxy-1'-methylspiro[1,3,4a,5-tetrahydrocyclopenta[c]pyran-4,4'-cyclohexene]-6-one.
| Compound Name | (3'S,4R,4aS)-3'-hydroxy-1'-methylspiro[1,3,4a,5-tetrahydrocyclopenta[c]pyran-4,4'-cyclohexene]-6-one |
|---|---|
| PubChem CID | 66559538 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (3'S,4R,4aS)-3'-hydroxy-1'-methylspiro[1,3,4a,5-tetrahydrocyclopenta[c]pyran-4,4'-cyclohexene]-6-one |
| SMILES | CC1=C[C@H](O)[C@@]2(CC1)COCC1=CC(=O)C[C@@H]12 |
| InChI | InChI=1S/C14H18O3/c1-9-2-3-14(13(16)4-9)8-17-7-10-5-11(15)6-12(10)14/h4-5,12-13,16H,2-3,6-8H2,1H3/t12-,13-,14-/m0/s1 |
| InChIKey | GRDHUIGJIPFHAY-IHRRRGAJSA-N |
| XLogP | 1.62 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|