C19H34O7 — CID 66559747
methyl 2-[(3S,4S,6R)-6-[(E,4S,7S)-4,7-dihydroxy-6-methylnon-5-enyl]-6-methoxy-4-methyldioxan-3-yl]acetate (PubChem CID 66559747) has the molecular formula C19H34O7 and a molecular weight of 374.47 g/mol. Its IUPAC name is methyl 2-[(3S,4S,6R)-6-[(E,4S,7S)-4,7-dihydroxy-6-methylnon-5-enyl]-6-methoxy-4-methyldioxan-3-yl]acetate.
| Compound Name | methyl 2-[(3S,4S,6R)-6-[(E,4S,7S)-4,7-dihydroxy-6-methylnon-5-enyl]-6-methoxy-4-methyldioxan-3-yl]acetate |
|---|---|
| PubChem CID | 66559747 |
| Molecular Formula | C19H34O7 |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | methyl 2-[(3S,4S,6R)-6-[(E,4S,7S)-4,7-dihydroxy-6-methylnon-5-enyl]-6-methoxy-4-methyldioxan-3-yl]acetate |
| SMILES | CC[C@H](O)/C(C)=C/[C@@H](O)CCC[C@]1(OC)C[C@H](C)[C@H](CC(=O)OC)OO1 |
| InChI | InChI=1S/C19H34O7/c1-6-16(21)13(2)10-15(20)8-7-9-19(24-5)12-14(3)17(25-26-19)11-18(22)23-4/h10,14-17,20-21H,6-9,11-12H2,1-5H3/b13-10+/t14-,15-,16-,17-,19+/m0/s1 |
| InChIKey | GXLGNLQTWCLWNH-HPZBCJOSSA-N |
| XLogP | 2.50 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|