C24H28F3N3O2 — CID 66559777
7-[4-[4-[2-(trifluoromethyl)phenyl]piperazin-1-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 66559777) has the molecular formula C24H28F3N3O2 and a molecular weight of 447.50 g/mol. Its IUPAC name is 7-[4-[4-[2-(trifluoromethyl)phenyl]piperazin-1-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 7-[4-[4-[2-(trifluoromethyl)phenyl]piperazin-1-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 66559777 |
| Molecular Formula | C24H28F3N3O2 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | 7-[4-[4-[2-(trifluoromethyl)phenyl]piperazin-1-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2ccc(OCCCCN3CCN(c4ccccc4C(F)(F)F)CC3)cc2N1 |
| InChI | InChI=1S/C24H28F3N3O2/c25-24(26,27)20-5-1-2-6-22(20)30-14-12-29(13-15-30)11-3-4-16-32-19-9-7-18-8-10-23(31)28-21(18)17-19/h1-2,5-7,9,17H,3-4,8,10-16H2,(H,28,31) |
| InChIKey | NXHZOGJHNYRAGN-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|