C17H30O3Si — CID 66559895
trimethyl-[2-[[(2R,3Z,6S)-6-prop-2-ynoxyocta-3,7-dien-2-yl]oxymethoxy]ethyl]silane (PubChem CID 66559895) has the molecular formula C17H30O3Si and a molecular weight of 310.51 g/mol. Its IUPAC name is trimethyl-[2-[[(2R,3Z,6S)-6-prop-2-ynoxyocta-3,7-dien-2-yl]oxymethoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[(2R,3Z,6S)-6-prop-2-ynoxyocta-3,7-dien-2-yl]oxymethoxy]ethyl]silane |
|---|---|
| PubChem CID | 66559895 |
| Molecular Formula | C17H30O3Si |
| Molecular Weight | 310.51 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | trimethyl-[2-[[(2R,3Z,6S)-6-prop-2-ynoxyocta-3,7-dien-2-yl]oxymethoxy]ethyl]silane |
| SMILES | C#CCO[C@H](C=C)C/C=C\[C@@H](C)OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C17H30O3Si/c1-7-12-19-17(8-2)11-9-10-16(3)20-15-18-13-14-21(4,5)6/h1,8-10,16-17H,2,11-15H2,3-6H3/b10-9-/t16-,17-/m1/s1 |
| InChIKey | XCGJVBHBNQRBFS-CZDHMLMNSA-N |
| XLogP | 3.85 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.51 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|