About 6,8-dipyridin-3-yl-3,4-dihydro-1H-quinolin-2-one
6,8-dipyridin-3-yl-3,4-dihydro-1H-quinolin-2-one (PubChem CID 66559941) has the molecular formula C19H15N3O
and a molecular weight of 301.35 g/mol. Its IUPAC name is 6,8-dipyridin-3-yl-3,4-dihydro-1H-quinolin-2-one.
Molecular Properties
| Compound Name | 6,8-dipyridin-3-yl-3,4-dihydro-1H-quinolin-2-one |
| PubChem CID | 66559941 |
| Molecular Formula | C19H15N3O |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 6,8-dipyridin-3-yl-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(-c3cccnc3)cc(-c3cccnc3)c2N1 |
| InChI | InChI=1S/C19H15N3O/c23-18-6-5-13-9-16(14-3-1-7-20-11-14)10-17(19(13)22-18)15-4-2-8-21-12-15/h1-4,7-12H,5-6H2,(H,22,23) |
| InChIKey | BWQZQKUWOGOVEF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,8-dipyridin-3-yl-3,4-dihydro-1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-dipyridin-3-yl-3,4-dihydro-1H-quinolin-2-one?
The IUPAC name of 6,8-dipyridin-3-yl-3,4-dihydro-1H-quinolin-2-one (CID 66559941) is 6,8-dipyridin-3-yl-3,4-dihydro-1H-quinolin-2-one.
What is the SMILES notation for 6,8-dipyridin-3-yl-3,4-dihydro-1H-quinolin-2-one?
The canonical SMILES for 6,8-dipyridin-3-yl-3,4-dihydro-1H-quinolin-2-one is O=C1CCc2cc(-c3cccnc3)cc(-c3cccnc3)c2N1.
What is the InChIKey of 6,8-dipyridin-3-yl-3,4-dihydro-1H-quinolin-2-one?
The InChIKey is BWQZQKUWOGOVEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15N3O/c23-18-6-5-13-9-16(14-3-1-7-20-11-14)10-17(19(13)22-18)15-4-2-8-21-12-15/h1-4,7-12H,5-6H2,(H,22,23).
What are the key properties of 6,8-dipyridin-3-yl-3,4-dihydro-1H-quinolin-2-one?
6,8-dipyridin-3-yl-3,4-dihydro-1H-quinolin-2-one has a molecular weight of 301.35 g/mol, XLogP of 3.70, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-dipyridin-3-yl-3,4-dihydro-1H-quinolin-2-one is sourced from PubChem (CID 66559941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).