C16H20O3 — CID 66559977
2,2-dimethylspiro[3,4,6,7,8,9-hexahydrobenzo[g]chromene-10,2'-oxirane]-5-one (PubChem CID 66559977) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is 2,2-dimethylspiro[3,4,6,7,8,9-hexahydrobenzo[g]chromene-10,2'-oxirane]-5-one.
| Compound Name | 2,2-dimethylspiro[3,4,6,7,8,9-hexahydrobenzo[g]chromene-10,2'-oxirane]-5-one |
|---|---|
| PubChem CID | 66559977 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 2,2-dimethylspiro[3,4,6,7,8,9-hexahydrobenzo[g]chromene-10,2'-oxirane]-5-one |
| SMILES | CC1(C)CCC2=C(O1)C1(CO1)C1=C(CCCC1)C2=O |
| InChI | InChI=1S/C16H20O3/c1-15(2)8-7-11-13(17)10-5-3-4-6-12(10)16(9-18-16)14(11)19-15/h3-9H2,1-2H3 |
| InChIKey | HYEFCMHBKILXLK-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|