C22H27N3O3 — CID 665600
1-[2-(cyclohexen-1-yl)ethyl]-1',6'-dimethylspiro[1,3-diazinane-5,3'-2,4-dihydroquinoline]-2,4,6-trione (PubChem CID 665600) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is 1-[2-(cyclohexen-1-yl)ethyl]-1',6'-dimethylspiro[1,3-diazinane-5,3'-2,4-dihydroquinoline]-2,4,6-trione.
| Compound Name | 1-[2-(cyclohexen-1-yl)ethyl]-1',6'-dimethylspiro[1,3-diazinane-5,3'-2,4-dihydroquinoline]-2,4,6-trione |
|---|---|
| PubChem CID | 665600 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 1-[2-(cyclohexen-1-yl)ethyl]-1',6'-dimethylspiro[1,3-diazinane-5,3'-2,4-dihydroquinoline]-2,4,6-trione |
| SMILES | Cc1ccc2c(c1)CC1(CN2C)C(=O)NC(=O)N(CCC2=CCCCC2)C1=O |
| InChI | InChI=1S/C22H27N3O3/c1-15-8-9-18-17(12-15)13-22(14-24(18)2)19(26)23-21(28)25(20(22)27)11-10-16-6-4-3-5-7-16/h6,8-9,12H,3-5,7,10-11,13-14H2,1-2H3,(H,23,26,28) |
| InChIKey | TYHZKRJCWFNMQA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|