C30H32N8O2S3 — CID 66560022
N-[[(2R)-1-[4-(but-3-enylamino)-6-[(2-thiophen-2-yl-1,3-thiazol-4-yl)methylamino]-1,3,5-triazin-2-yl]pyrrolidin-2-yl]methyl]naphthalene-2-sulfonamide (PubChem CID 66560022) has the molecular formula C30H32N8O2S3 and a molecular weight of 632.84 g/mol. Its IUPAC name is N-[[(2R)-1-[4-(but-3-enylamino)-6-[(2-thiophen-2-yl-1,3-thiazol-4-yl)methylamino]-1,3,5-triazin-2-yl]pyrrolidin-2-yl]methyl]naphthalene-2-sulfonamide.
| Compound Name | N-[[(2R)-1-[4-(but-3-enylamino)-6-[(2-thiophen-2-yl-1,3-thiazol-4-yl)methylamino]-1,3,5-triazin-2-yl]pyrrolidin-2-yl]methyl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 66560022 |
| Molecular Formula | C30H32N8O2S3 |
| Molecular Weight | 632.84 g/mol |
| Exact Mass | 632.18 |
| IUPAC Name | N-[[(2R)-1-[4-(but-3-enylamino)-6-[(2-thiophen-2-yl-1,3-thiazol-4-yl)methylamino]-1,3,5-triazin-2-yl]pyrrolidin-2-yl]methyl]naphthalene-2-sulfonamide |
| SMILES | C=CCCNc1nc(NCc2csc(-c3cccs3)n2)nc(N2CCC[C@@H]2CNS(=O)(=O)c2ccc3ccccc3c2)n1 |
| InChI | InChI=1S/C30H32N8O2S3/c1-2-3-14-31-28-35-29(32-18-23-20-42-27(34-23)26-11-7-16-41-26)37-30(36-28)38-15-6-10-24(38)19-33-43(39,40)25-13-12-21-8-4-5-9-22(21)17-25/h2,4-5,7-9,11-13,16-17,20,24,33H,1,3,6,10,14-15,18-19H2,(H2,31,32,35,36,37)/t24-/m1/s1 |
| InChIKey | MZFVSYXTBIQFNO-XMMPIXPASA-N |
| XLogP | 5.76 |
| TPSA | 125.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.84 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|