About 6,8-dibromo-2-pentyl-2,3-dihydrochromen-4-one
6,8-dibromo-2-pentyl-2,3-dihydrochromen-4-one (PubChem CID 66560225) has the molecular formula C14H16Br2O2
and a molecular weight of 376.09 g/mol. Its IUPAC name is 6,8-dibromo-2-pentyl-2,3-dihydrochromen-4-one.
Molecular Properties
| Compound Name | 6,8-dibromo-2-pentyl-2,3-dihydrochromen-4-one |
| PubChem CID | 66560225 |
| Molecular Formula | C14H16Br2O2 |
| Molecular Weight | 376.09 g/mol |
| Exact Mass | 373.95 |
| IUPAC Name | 6,8-dibromo-2-pentyl-2,3-dihydrochromen-4-one |
| SMILES | CCCCCC1CC(=O)c2cc(Br)cc(Br)c2O1 |
| InChI | InChI=1S/C14H16Br2O2/c1-2-3-4-5-10-8-13(17)11-6-9(15)7-12(16)14(11)18-10/h6-7,10H,2-5,8H2,1H3 |
| InChIKey | RQNQNBFICWKDSG-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.09 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6,8-dibromo-2-pentyl-2,3-dihydrochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-dibromo-2-pentyl-2,3-dihydrochromen-4-one?
The IUPAC name of 6,8-dibromo-2-pentyl-2,3-dihydrochromen-4-one (CID 66560225) is 6,8-dibromo-2-pentyl-2,3-dihydrochromen-4-one.
What is the SMILES notation for 6,8-dibromo-2-pentyl-2,3-dihydrochromen-4-one?
The canonical SMILES for 6,8-dibromo-2-pentyl-2,3-dihydrochromen-4-one is CCCCCC1CC(=O)c2cc(Br)cc(Br)c2O1.
What is the InChIKey of 6,8-dibromo-2-pentyl-2,3-dihydrochromen-4-one?
The InChIKey is RQNQNBFICWKDSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16Br2O2/c1-2-3-4-5-10-8-13(17)11-6-9(15)7-12(16)14(11)18-10/h6-7,10H,2-5,8H2,1H3.
What are the key properties of 6,8-dibromo-2-pentyl-2,3-dihydrochromen-4-one?
6,8-dibromo-2-pentyl-2,3-dihydrochromen-4-one has a molecular weight of 376.09 g/mol, XLogP of 5.13, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-dibromo-2-pentyl-2,3-dihydrochromen-4-one is sourced from PubChem (CID 66560225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).