C26H28N2O3 — CID 66560837
(5aS,7S)-3-methyl-7-[1-(quinolin-4-ylmethylamino)propan-2-yl]-6,7,8,9-tetrahydro-5aH-pyrano[4,3-b]chromen-1-one (PubChem CID 66560837) has the molecular formula C26H28N2O3 and a molecular weight of 416.52 g/mol. Its IUPAC name is (5aS,7S)-3-methyl-7-[1-(quinolin-4-ylmethylamino)propan-2-yl]-6,7,8,9-tetrahydro-5aH-pyrano[4,3-b]chromen-1-one.
| Compound Name | (5aS,7S)-3-methyl-7-[1-(quinolin-4-ylmethylamino)propan-2-yl]-6,7,8,9-tetrahydro-5aH-pyrano[4,3-b]chromen-1-one |
|---|---|
| PubChem CID | 66560837 |
| Molecular Formula | C26H28N2O3 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | (5aS,7S)-3-methyl-7-[1-(quinolin-4-ylmethylamino)propan-2-yl]-6,7,8,9-tetrahydro-5aH-pyrano[4,3-b]chromen-1-one |
| SMILES | Cc1cc2c(c(=O)o1)C=C1CC[C@H](C(C)CNCc3ccnc4ccccc34)C[C@@H]1O2 |
| InChI | InChI=1S/C26H28N2O3/c1-16(14-27-15-20-9-10-28-23-6-4-3-5-21(20)23)18-7-8-19-12-22-25(31-24(19)13-18)11-17(2)30-26(22)29/h3-6,9-12,16,18,24,27H,7-8,13-15H2,1-2H3/t16?,18-,24-/m0/s1 |
| InChIKey | JDHAHJSZFPOWTA-UUOAJKPESA-N |
| XLogP | 4.87 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |