C16H10N2O4 — CID 66561017
2-(3-ethyl-1,2,4-oxadiazol-5-yl)benzo[f][1]benzofuran-4,9-dione (PubChem CID 66561017) has the molecular formula C16H10N2O4 and a molecular weight of 294.27 g/mol. Its IUPAC name is 2-(3-ethyl-1,2,4-oxadiazol-5-yl)benzo[f][1]benzofuran-4,9-dione.
| Compound Name | 2-(3-ethyl-1,2,4-oxadiazol-5-yl)benzo[f][1]benzofuran-4,9-dione |
|---|---|
| PubChem CID | 66561017 |
| Molecular Formula | C16H10N2O4 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 2-(3-ethyl-1,2,4-oxadiazol-5-yl)benzo[f][1]benzofuran-4,9-dione |
| SMILES | CCc1noc(-c2cc3c(o2)C(=O)c2ccccc2C3=O)n1 |
| InChI | InChI=1S/C16H10N2O4/c1-2-12-17-16(22-18-12)11-7-10-13(19)8-5-3-4-6-9(8)14(20)15(10)21-11/h3-7H,2H2,1H3 |
| InChIKey | QTTBVKDJGZXCAD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 86.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|