About (4R,5R)-4,5-diisocyanatocyclohexene
(4R,5R)-4,5-diisocyanatocyclohexene (PubChem CID 66561056) has the molecular formula C8H8N2O2
and a molecular weight of 164.16 g/mol. Its IUPAC name is (4R,5R)-4,5-diisocyanatocyclohexene.
Molecular Properties
| Compound Name | (4R,5R)-4,5-diisocyanatocyclohexene |
| PubChem CID | 66561056 |
| Molecular Formula | C8H8N2O2 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | (4R,5R)-4,5-diisocyanatocyclohexene |
| SMILES | O=C=N[C@@H]1CC=CC[C@H]1N=C=O |
| InChI | InChI=1S/C8H8N2O2/c11-5-9-7-3-1-2-4-8(7)10-6-12/h1-2,7-8H,3-4H2/t7-,8-/m1/s1 |
| InChIKey | QSNHRMQOFWHOSC-HTQZYQBOSA-N |
| XLogP | 0.75 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4R,5R)-4,5-diisocyanatocyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R,5R)-4,5-diisocyanatocyclohexene?
The IUPAC name of (4R,5R)-4,5-diisocyanatocyclohexene (CID 66561056) is (4R,5R)-4,5-diisocyanatocyclohexene.
What is the SMILES notation for (4R,5R)-4,5-diisocyanatocyclohexene?
The canonical SMILES for (4R,5R)-4,5-diisocyanatocyclohexene is O=C=N[C@@H]1CC=CC[C@H]1N=C=O.
What is the InChIKey of (4R,5R)-4,5-diisocyanatocyclohexene?
The InChIKey is QSNHRMQOFWHOSC-HTQZYQBOSA-N. The full InChI is InChI=1S/C8H8N2O2/c11-5-9-7-3-1-2-4-8(7)10-6-12/h1-2,7-8H,3-4H2/t7-,8-/m1/s1.
What are the key properties of (4R,5R)-4,5-diisocyanatocyclohexene?
(4R,5R)-4,5-diisocyanatocyclohexene has a molecular weight of 164.16 g/mol, XLogP of 0.75, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4R,5R)-4,5-diisocyanatocyclohexene is sourced from PubChem (CID 66561056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).