C13H8Cl2N6S — CID 665611
6-(2,4-dichlorophenyl)-3-(5-methyl-1H-pyrazol-3-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 665611) has the molecular formula C13H8Cl2N6S and a molecular weight of 351.22 g/mol. Its IUPAC name is 6-(2,4-dichlorophenyl)-3-(5-methyl-1H-pyrazol-3-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 6-(2,4-dichlorophenyl)-3-(5-methyl-1H-pyrazol-3-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 665611 |
| Molecular Formula | C13H8Cl2N6S |
| Molecular Weight | 351.22 g/mol |
| Exact Mass | 349.99 |
| IUPAC Name | 6-(2,4-dichlorophenyl)-3-(5-methyl-1H-pyrazol-3-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | Cc1cc(-c2nnc3sc(-c4ccc(Cl)cc4Cl)nn23)n[nH]1 |
| InChI | InChI=1S/C13H8Cl2N6S/c1-6-4-10(17-16-6)11-18-19-13-21(11)20-12(22-13)8-3-2-7(14)5-9(8)15/h2-5H,1H3,(H,16,17) |
| InChIKey | KRTGAVXTNVIROC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.22 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |