About 4-[2-amino-5-(4-amino-2,6-dimethylphenoxy)-4-(trifluoromethyl)anilino]benzonitrile
4-[2-amino-5-(4-amino-2,6-dimethylphenoxy)-4-(trifluoromethyl)anilino]benzonitrile (PubChem CID 66561258) has the molecular formula C22H19F3N4O
and a molecular weight of 412.42 g/mol. Its IUPAC name is 4-[2-amino-5-(4-amino-2,6-dimethylphenoxy)-4-(trifluoromethyl)anilino]benzonitrile.
Molecular Properties
| Compound Name | 4-[2-amino-5-(4-amino-2,6-dimethylphenoxy)-4-(trifluoromethyl)anilino]benzonitrile |
| PubChem CID | 66561258 |
| Molecular Formula | C22H19F3N4O |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 4-[2-amino-5-(4-amino-2,6-dimethylphenoxy)-4-(trifluoromethyl)anilino]benzonitrile |
| SMILES | Cc1cc(N)cc(C)c1Oc1cc(Nc2ccc(C#N)cc2)c(N)cc1C(F)(F)F |
| InChI | InChI=1S/C22H19F3N4O/c1-12-7-15(27)8-13(2)21(12)30-20-10-19(18(28)9-17(20)22(23,24)25)29-16-5-3-14(11-26)4-6-16/h3-10,29H,27-28H2,1-2H3 |
| InChIKey | GXWYEBVCFIZZDB-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 97.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-amino-5-(4-amino-2,6-dimethylphenoxy)-4-(trifluoromethyl)anilino]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-amino-5-(4-amino-2,6-dimethylphenoxy)-4-(trifluoromethyl)anilino]benzonitrile?
The IUPAC name of 4-[2-amino-5-(4-amino-2,6-dimethylphenoxy)-4-(trifluoromethyl)anilino]benzonitrile (CID 66561258) is 4-[2-amino-5-(4-amino-2,6-dimethylphenoxy)-4-(trifluoromethyl)anilino]benzonitrile.
What is the SMILES notation for 4-[2-amino-5-(4-amino-2,6-dimethylphenoxy)-4-(trifluoromethyl)anilino]benzonitrile?
The canonical SMILES for 4-[2-amino-5-(4-amino-2,6-dimethylphenoxy)-4-(trifluoromethyl)anilino]benzonitrile is Cc1cc(N)cc(C)c1Oc1cc(Nc2ccc(C#N)cc2)c(N)cc1C(F)(F)F.
What is the InChIKey of 4-[2-amino-5-(4-amino-2,6-dimethylphenoxy)-4-(trifluoromethyl)anilino]benzonitrile?
The InChIKey is GXWYEBVCFIZZDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19F3N4O/c1-12-7-15(27)8-13(2)21(12)30-20-10-19(18(28)9-17(20)22(23,24)25)29-16-5-3-14(11-26)4-6-16/h3-10,29H,27-28H2,1-2H3.
What are the key properties of 4-[2-amino-5-(4-amino-2,6-dimethylphenoxy)-4-(trifluoromethyl)anilino]benzonitrile?
4-[2-amino-5-(4-amino-2,6-dimethylphenoxy)-4-(trifluoromethyl)anilino]benzonitrile has a molecular weight of 412.42 g/mol, XLogP of 5.89, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-amino-5-(4-amino-2,6-dimethylphenoxy)-4-(trifluoromethyl)anilino]benzonitrile is sourced from PubChem (CID 66561258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).