C17H17N2O7P — CID 66561588
5-methyl-1-[(2R,5S)-5-[[(2S)-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl]oxymethyl]-2,5-dihydrofuran-2-yl]pyrimidine-2,4-dione (PubChem CID 66561588) has the molecular formula C17H17N2O7P and a molecular weight of 392.30 g/mol. Its IUPAC name is 5-methyl-1-[(2R,5S)-5-[[(2S)-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl]oxymethyl]-2,5-dihydrofuran-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-methyl-1-[(2R,5S)-5-[[(2S)-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl]oxymethyl]-2,5-dihydrofuran-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 66561588 |
| Molecular Formula | C17H17N2O7P |
| Molecular Weight | 392.30 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 5-methyl-1-[(2R,5S)-5-[[(2S)-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl]oxymethyl]-2,5-dihydrofuran-2-yl]pyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2C=C[C@@H](CO[P@]3(=O)OCc4ccccc4O3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C17H17N2O7P/c1-11-8-19(17(21)18-16(11)20)15-7-6-13(25-15)10-24-27(22)23-9-12-4-2-3-5-14(12)26-27/h2-8,13,15H,9-10H2,1H3,(H,18,20,21)/t13-,15+,27-/m0/s1 |
| InChIKey | NEUXRWCLDPVEMR-LGMFNTMXSA-N |
| XLogP | 2.03 |
| TPSA | 108.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|