C18H19N2O7P — CID 66561661
5-methyl-1-[(2R,5S)-5-[[(2R)-6-methyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl]oxymethyl]-2,5-dihydrofuran-2-yl]pyrimidine-2,4-dione (PubChem CID 66561661) has the molecular formula C18H19N2O7P and a molecular weight of 406.33 g/mol. Its IUPAC name is 5-methyl-1-[(2R,5S)-5-[[(2R)-6-methyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl]oxymethyl]-2,5-dihydrofuran-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-methyl-1-[(2R,5S)-5-[[(2R)-6-methyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl]oxymethyl]-2,5-dihydrofuran-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 66561661 |
| Molecular Formula | C18H19N2O7P |
| Molecular Weight | 406.33 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 5-methyl-1-[(2R,5S)-5-[[(2R)-6-methyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl]oxymethyl]-2,5-dihydrofuran-2-yl]pyrimidine-2,4-dione |
| SMILES | Cc1ccc2c(c1)CO[P@](=O)(OC[C@@H]1C=C[C@H](n3cc(C)c(=O)[nH]c3=O)O1)O2 |
| InChI | InChI=1S/C18H19N2O7P/c1-11-3-5-15-13(7-11)9-24-28(23,27-15)25-10-14-4-6-16(26-14)20-8-12(2)17(21)19-18(20)22/h3-8,14,16H,9-10H2,1-2H3,(H,19,21,22)/t14-,16+,28+/m0/s1 |
| InChIKey | XCQZHNHBKUHUEJ-WLHIUKMVSA-N |
| XLogP | 2.34 |
| TPSA | 108.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.33 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|