C22H22F3NO2 — CID 66561722
3,6-dimethyl-9-[4-(trifluoromethyl)phenyl]-2,3,4,5,6,7,9,10-octahydroacridine-1,8-dione (PubChem CID 66561722) has the molecular formula C22H22F3NO2 and a molecular weight of 389.42 g/mol. Its IUPAC name is 3,6-dimethyl-9-[4-(trifluoromethyl)phenyl]-2,3,4,5,6,7,9,10-octahydroacridine-1,8-dione.
| Compound Name | 3,6-dimethyl-9-[4-(trifluoromethyl)phenyl]-2,3,4,5,6,7,9,10-octahydroacridine-1,8-dione |
|---|---|
| PubChem CID | 66561722 |
| Molecular Formula | C22H22F3NO2 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 3,6-dimethyl-9-[4-(trifluoromethyl)phenyl]-2,3,4,5,6,7,9,10-octahydroacridine-1,8-dione |
| SMILES | CC1CC(=O)C2=C(C1)NC1=C(C(=O)CC(C)C1)C2c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H22F3NO2/c1-11-7-15-20(17(27)9-11)19(13-3-5-14(6-4-13)22(23,24)25)21-16(26-15)8-12(2)10-18(21)28/h3-6,11-12,19,26H,7-10H2,1-2H3 |
| InChIKey | AUASGMUVCMNFTK-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |