C29H54O5Si — CID 66561943
[(2S)-1-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]undecan-2-yl] (3R)-3-[tert-butyl(dimethyl)silyl]oxypent-4-enoate (PubChem CID 66561943) has the molecular formula C29H54O5Si and a molecular weight of 510.83 g/mol. Its IUPAC name is [(2S)-1-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]undecan-2-yl] (3R)-3-[tert-butyl(dimethyl)silyl]oxypent-4-enoate.
| Compound Name | [(2S)-1-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]undecan-2-yl] (3R)-3-[tert-butyl(dimethyl)silyl]oxypent-4-enoate |
|---|---|
| PubChem CID | 66561943 |
| Molecular Formula | C29H54O5Si |
| Molecular Weight | 510.83 g/mol |
| Exact Mass | 510.37 |
| IUPAC Name | [(2S)-1-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]undecan-2-yl] (3R)-3-[tert-butyl(dimethyl)silyl]oxypent-4-enoate |
| SMILES | C=C[C@@H](CC(=O)O[C@@H](CCCCCCCCC)C[C@H]1OC(C)(C)O[C@@H]1C=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H54O5Si/c1-11-14-15-16-17-18-19-20-24(21-26-25(13-3)32-29(7,8)33-26)31-27(30)22-23(12-2)34-35(9,10)28(4,5)6/h12-13,23-26H,2-3,11,14-22H2,1,4-10H3/t23-,24-,25+,26+/m0/s1 |
| InChIKey | OAELNIFOVSXODY-QEGGNFSNSA-N |
| XLogP | 8.10 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.83 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|