C21H27F3N4O4S — CID 66562130
3-[4-[(1R,2S)-2-[2-[(5-methylsulfonyl-2-pyridinyl)oxy]ethyl]cyclopropyl]piperidin-1-yl]-5-(3,3,3-trifluoropropyl)-1,2,4-oxadiazole (PubChem CID 66562130) has the molecular formula C21H27F3N4O4S and a molecular weight of 488.53 g/mol. Its IUPAC name is 3-[4-[(1R,2S)-2-[2-[(5-methylsulfonyl-2-pyridinyl)oxy]ethyl]cyclopropyl]piperidin-1-yl]-5-(3,3,3-trifluoropropyl)-1,2,4-oxadiazole.
| Compound Name | 3-[4-[(1R,2S)-2-[2-[(5-methylsulfonyl-2-pyridinyl)oxy]ethyl]cyclopropyl]piperidin-1-yl]-5-(3,3,3-trifluoropropyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 66562130 |
| Molecular Formula | C21H27F3N4O4S |
| Molecular Weight | 488.53 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | 3-[4-[(1R,2S)-2-[2-[(5-methylsulfonyl-2-pyridinyl)oxy]ethyl]cyclopropyl]piperidin-1-yl]-5-(3,3,3-trifluoropropyl)-1,2,4-oxadiazole |
| SMILES | CS(=O)(=O)c1ccc(OCC[C@@H]2C[C@@H]2C2CCN(c3noc(CCC(F)(F)F)n3)CC2)nc1 |
| InChI | InChI=1S/C21H27F3N4O4S/c1-33(29,30)16-2-3-18(25-13-16)31-11-7-15-12-17(15)14-5-9-28(10-6-14)20-26-19(32-27-20)4-8-21(22,23)24/h2-3,13-15,17H,4-12H2,1H3/t15-,17-/m1/s1 |
| InChIKey | HHODDUHKIVPDPJ-NVXWUHKLSA-N |
| XLogP | 3.68 |
| TPSA | 98.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.53 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |