About 2-decyl-1-hydroxy-3,5,6-trimethylpyridin-4-one
2-decyl-1-hydroxy-3,5,6-trimethylpyridin-4-one (PubChem CID 66562300) has the molecular formula C18H31NO2
and a molecular weight of 293.45 g/mol. Its IUPAC name is 2-decyl-1-hydroxy-3,5,6-trimethylpyridin-4-one.
Molecular Properties
| Compound Name | 2-decyl-1-hydroxy-3,5,6-trimethylpyridin-4-one |
| PubChem CID | 66562300 |
| Molecular Formula | C18H31NO2 |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.24 |
| IUPAC Name | 2-decyl-1-hydroxy-3,5,6-trimethylpyridin-4-one |
| SMILES | CCCCCCCCCCc1c(C)c(=O)c(C)c(C)n1O |
| InChI | InChI=1S/C18H31NO2/c1-5-6-7-8-9-10-11-12-13-17-15(3)18(20)14(2)16(4)19(17)21/h21H,5-13H2,1-4H3 |
| InChIKey | CSHZTDUVQKLSJG-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-decyl-1-hydroxy-3,5,6-trimethylpyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-decyl-1-hydroxy-3,5,6-trimethylpyridin-4-one?
The IUPAC name of 2-decyl-1-hydroxy-3,5,6-trimethylpyridin-4-one (CID 66562300) is 2-decyl-1-hydroxy-3,5,6-trimethylpyridin-4-one.
What is the SMILES notation for 2-decyl-1-hydroxy-3,5,6-trimethylpyridin-4-one?
The canonical SMILES for 2-decyl-1-hydroxy-3,5,6-trimethylpyridin-4-one is CCCCCCCCCCc1c(C)c(=O)c(C)c(C)n1O.
What is the InChIKey of 2-decyl-1-hydroxy-3,5,6-trimethylpyridin-4-one?
The InChIKey is CSHZTDUVQKLSJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H31NO2/c1-5-6-7-8-9-10-11-12-13-17-15(3)18(20)14(2)16(4)19(17)21/h21H,5-13H2,1-4H3.
What are the key properties of 2-decyl-1-hydroxy-3,5,6-trimethylpyridin-4-one?
2-decyl-1-hydroxy-3,5,6-trimethylpyridin-4-one has a molecular weight of 293.45 g/mol, XLogP of 4.69, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-decyl-1-hydroxy-3,5,6-trimethylpyridin-4-one is sourced from PubChem (CID 66562300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).