C17H11Cl2FO2 — CID 66562392
3-[4-[2-(3,5-dichlorophenyl)ethynyl]-2-fluorophenyl]propanoic acid (PubChem CID 66562392) has the molecular formula C17H11Cl2FO2 and a molecular weight of 337.18 g/mol. Its IUPAC name is 3-[4-[2-(3,5-dichlorophenyl)ethynyl]-2-fluorophenyl]propanoic acid.
| Compound Name | 3-[4-[2-(3,5-dichlorophenyl)ethynyl]-2-fluorophenyl]propanoic acid |
|---|---|
| PubChem CID | 66562392 |
| Molecular Formula | C17H11Cl2FO2 |
| Molecular Weight | 337.18 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | 3-[4-[2-(3,5-dichlorophenyl)ethynyl]-2-fluorophenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(C#Cc2cc(Cl)cc(Cl)c2)cc1F |
| InChI | InChI=1S/C17H11Cl2FO2/c18-14-7-12(8-15(19)10-14)2-1-11-3-4-13(16(20)9-11)5-6-17(21)22/h3-4,7-10H,5-6H2,(H,21,22) |
| InChIKey | XGXBPJNMEMVRKQ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.18 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|