C24H29NO5S — CID 66562630
(2S,3R,4R,5S,6S)-2-[4-cyclopropyl-3-(3,4-dihydro-2H-1,4-benzothiazin-6-ylmethyl)phenyl]-6-methoxyoxane-3,4,5-triol (PubChem CID 66562630) has the molecular formula C24H29NO5S and a molecular weight of 443.57 g/mol. Its IUPAC name is (2S,3R,4R,5S,6S)-2-[4-cyclopropyl-3-(3,4-dihydro-2H-1,4-benzothiazin-6-ylmethyl)phenyl]-6-methoxyoxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6S)-2-[4-cyclopropyl-3-(3,4-dihydro-2H-1,4-benzothiazin-6-ylmethyl)phenyl]-6-methoxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 66562630 |
| Molecular Formula | C24H29NO5S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | (2S,3R,4R,5S,6S)-2-[4-cyclopropyl-3-(3,4-dihydro-2H-1,4-benzothiazin-6-ylmethyl)phenyl]-6-methoxyoxane-3,4,5-triol |
| SMILES | CO[C@H]1O[C@@H](c2ccc(C3CC3)c(Cc3ccc4c(c3)NCCS4)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H29NO5S/c1-29-24-22(28)20(26)21(27)23(30-24)15-5-6-17(14-3-4-14)16(12-15)10-13-2-7-19-18(11-13)25-8-9-31-19/h2,5-7,11-12,14,20-28H,3-4,8-10H2,1H3/t20-,21-,22+,23+,24+/m1/s1 |
| InChIKey | WDKZMLOCENOIFW-DJCPXJLLSA-N |
| XLogP | 2.80 |
| TPSA | 91.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |