C16H20F3N3O3S — CID 66562863
N-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4-fluorophenyl]-2,2-difluoropropanamide (PubChem CID 66562863) has the molecular formula C16H20F3N3O3S and a molecular weight of 391.42 g/mol. Its IUPAC name is N-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4-fluorophenyl]-2,2-difluoropropanamide.
| Compound Name | N-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4-fluorophenyl]-2,2-difluoropropanamide |
|---|---|
| PubChem CID | 66562863 |
| Molecular Formula | C16H20F3N3O3S |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | N-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4-fluorophenyl]-2,2-difluoropropanamide |
| SMILES | CC(F)(F)C(=O)Nc1ccc(F)c([C@]2(C)CS(=O)(=O)C(C)(C)C(N)=N2)c1 |
| InChI | InChI=1S/C16H20F3N3O3S/c1-14(2)12(20)22-15(3,8-26(14,24)25)10-7-9(5-6-11(10)17)21-13(23)16(4,18)19/h5-7H,8H2,1-4H3,(H2,20,22)(H,21,23)/t15-/m0/s1 |
| InChIKey | IYRBXXIGHWZJGZ-HNNXBMFYSA-N |
| XLogP | 2.20 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |