C15H18F3N3O3S — CID 66562958
N-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4-fluorophenyl]-2,2-difluoroacetamide (PubChem CID 66562958) has the molecular formula C15H18F3N3O3S and a molecular weight of 377.39 g/mol. Its IUPAC name is N-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4-fluorophenyl]-2,2-difluoroacetamide.
| Compound Name | N-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4-fluorophenyl]-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 66562958 |
| Molecular Formula | C15H18F3N3O3S |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | N-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4-fluorophenyl]-2,2-difluoroacetamide |
| SMILES | CC1(C)C(N)=N[C@](C)(c2cc(NC(=O)C(F)F)ccc2F)CS1(=O)=O |
| InChI | InChI=1S/C15H18F3N3O3S/c1-14(2)13(19)21-15(3,7-25(14,23)24)9-6-8(4-5-10(9)16)20-12(22)11(17)18/h4-6,11H,7H2,1-3H3,(H2,19,21)(H,20,22)/t15-/m0/s1 |
| InChIKey | KZHHGWZRVHNVGN-HNNXBMFYSA-N |
| XLogP | 1.81 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |