C18H22F3N3O3S — CID 66562959
N-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4-fluorophenyl]-2,2-difluorocyclobutane-1-carboxamide (PubChem CID 66562959) has the molecular formula C18H22F3N3O3S and a molecular weight of 417.45 g/mol. Its IUPAC name is N-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4-fluorophenyl]-2,2-difluorocyclobutane-1-carboxamide.
| Compound Name | N-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4-fluorophenyl]-2,2-difluorocyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 66562959 |
| Molecular Formula | C18H22F3N3O3S |
| Molecular Weight | 417.45 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | N-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4-fluorophenyl]-2,2-difluorocyclobutane-1-carboxamide |
| SMILES | CC1(C)C(N)=N[C@](C)(c2cc(NC(=O)C3CCC3(F)F)ccc2F)CS1(=O)=O |
| InChI | InChI=1S/C18H22F3N3O3S/c1-16(2)15(22)24-17(3,9-28(16,26)27)12-8-10(4-5-13(12)19)23-14(25)11-6-7-18(11,20)21/h4-5,8,11H,6-7,9H2,1-3H3,(H2,22,24)(H,23,25)/t11?,17-/m0/s1 |
| InChIKey | DEQBGKOLUVGSOL-KLLZUTDZSA-N |
| XLogP | 2.59 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.45 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |