C18H23F2N3O4S — CID 66563058
(2R)-N-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4,5-difluorophenyl]oxolane-2-carboxamide (PubChem CID 66563058) has the molecular formula C18H23F2N3O4S and a molecular weight of 415.46 g/mol. Its IUPAC name is (2R)-N-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4,5-difluorophenyl]oxolane-2-carboxamide.
| Compound Name | (2R)-N-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4,5-difluorophenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 66563058 |
| Molecular Formula | C18H23F2N3O4S |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | (2R)-N-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4,5-difluorophenyl]oxolane-2-carboxamide |
| SMILES | CC1(C)C(N)=N[C@](C)(c2cc(NC(=O)[C@H]3CCCO3)cc(F)c2F)CS1(=O)=O |
| InChI | InChI=1S/C18H23F2N3O4S/c1-17(2)16(21)23-18(3,9-28(17,25)26)11-7-10(8-12(19)14(11)20)22-15(24)13-5-4-6-27-13/h7-8,13H,4-6,9H2,1-3H3,(H2,21,23)(H,22,24)/t13-,18+/m1/s1 |
| InChIKey | NYKPPWOSEHBBRT-ACJLOTCBSA-N |
| XLogP | 1.86 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |