C15H19F2N3O3S — CID 66563059
N-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4,5-difluorophenyl]acetamide (PubChem CID 66563059) has the molecular formula C15H19F2N3O3S and a molecular weight of 359.40 g/mol. Its IUPAC name is N-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4,5-difluorophenyl]acetamide.
| Compound Name | N-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4,5-difluorophenyl]acetamide |
|---|---|
| PubChem CID | 66563059 |
| Molecular Formula | C15H19F2N3O3S |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | N-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4,5-difluorophenyl]acetamide |
| SMILES | CC(=O)Nc1cc(F)c(F)c([C@]2(C)CS(=O)(=O)C(C)(C)C(N)=N2)c1 |
| InChI | InChI=1S/C15H19F2N3O3S/c1-8(21)19-9-5-10(12(17)11(16)6-9)15(4)7-24(22,23)14(2,3)13(18)20-15/h5-6H,7H2,1-4H3,(H2,18,20)(H,19,21)/t15-/m0/s1 |
| InChIKey | KUJNPRLBIAHYQF-HNNXBMFYSA-N |
| XLogP | 1.70 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |