C28H29FN6O2 — CID 66563469
11-(3-ethoxy-5-fluorophenyl)-8-ethyl-16-methyl-5-piperazin-1-yl-8,12,14,15-tetrazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2(7),3,5,11,13,16-heptaen-9-one (PubChem CID 66563469) has the molecular formula C28H29FN6O2 and a molecular weight of 500.58 g/mol. Its IUPAC name is 11-(3-ethoxy-5-fluorophenyl)-8-ethyl-16-methyl-5-piperazin-1-yl-8,12,14,15-tetrazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2(7),3,5,11,13,16-heptaen-9-one.
| Compound Name | 11-(3-ethoxy-5-fluorophenyl)-8-ethyl-16-methyl-5-piperazin-1-yl-8,12,14,15-tetrazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2(7),3,5,11,13,16-heptaen-9-one |
|---|---|
| PubChem CID | 66563469 |
| Molecular Formula | C28H29FN6O2 |
| Molecular Weight | 500.58 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | 11-(3-ethoxy-5-fluorophenyl)-8-ethyl-16-methyl-5-piperazin-1-yl-8,12,14,15-tetrazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2(7),3,5,11,13,16-heptaen-9-one |
| SMILES | CCOc1cc(F)cc(-c2nc3n[nH]c(C)c3c3c2c(=O)n(CC)c2cc(N4CCNCC4)ccc32)c1 |
| InChI | InChI=1S/C28H29FN6O2/c1-4-35-22-15-19(34-10-8-30-9-11-34)6-7-21(22)24-23-16(3)32-33-27(23)31-26(25(24)28(35)36)17-12-18(29)14-20(13-17)37-5-2/h6-7,12-15,30H,4-5,8-11H2,1-3H3,(H,31,32,33) |
| InChIKey | VOIWWCQDJGQURV-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.58 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|