C25H28ClF2NO6S2 — CID 66563571
(2S)-2-[2-[(4S,4aS,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromen-4-yl]ethylsulfonylmethyl]pyrrolidine (PubChem CID 66563571) has the molecular formula C25H28ClF2NO6S2 and a molecular weight of 576.08 g/mol. Its IUPAC name is (2S)-2-[2-[(4S,4aS,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromen-4-yl]ethylsulfonylmethyl]pyrrolidine.
| Compound Name | (2S)-2-[2-[(4S,4aS,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromen-4-yl]ethylsulfonylmethyl]pyrrolidine |
|---|---|
| PubChem CID | 66563571 |
| Molecular Formula | C25H28ClF2NO6S2 |
| Molecular Weight | 576.08 g/mol |
| Exact Mass | 575.10 |
| IUPAC Name | (2S)-2-[2-[(4S,4aS,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromen-4-yl]ethylsulfonylmethyl]pyrrolidine |
| SMILES | O=S(=O)(CC[C@@H]1OCC[C@@]2(S(=O)(=O)c3ccc(Cl)cc3)c3c(F)ccc(F)c3OC[C@@H]12)C[C@@H]1CCCN1 |
| InChI | InChI=1S/C25H28ClF2NO6S2/c26-16-3-5-18(6-4-16)37(32,33)25-10-12-34-22(9-13-36(30,31)15-17-2-1-11-29-17)19(25)14-35-24-21(28)8-7-20(27)23(24)25/h3-8,17,19,22,29H,1-2,9-15H2/t17-,19-,22-,25-/m0/s1 |
| InChIKey | HJFUEOSIZHFJQY-JNLMMFOCSA-N |
| XLogP | 3.64 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.08 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |