C14H15Cl3N4O2 — CID 66563689
6-methyl-5-[3-(2,4,5-trichlorophenoxy)propoxy]pyrimidine-2,4-diamine (PubChem CID 66563689) has the molecular formula C14H15Cl3N4O2 and a molecular weight of 377.66 g/mol. Its IUPAC name is 6-methyl-5-[3-(2,4,5-trichlorophenoxy)propoxy]pyrimidine-2,4-diamine.
| Compound Name | 6-methyl-5-[3-(2,4,5-trichlorophenoxy)propoxy]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 66563689 |
| Molecular Formula | C14H15Cl3N4O2 |
| Molecular Weight | 377.66 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | 6-methyl-5-[3-(2,4,5-trichlorophenoxy)propoxy]pyrimidine-2,4-diamine |
| SMILES | Cc1nc(N)nc(N)c1OCCCOc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H15Cl3N4O2/c1-7-12(13(18)21-14(19)20-7)23-4-2-3-22-11-6-9(16)8(15)5-10(11)17/h5-6H,2-4H2,1H3,(H4,18,19,20,21) |
| InChIKey | KNUBCZHIBGZRJT-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 96.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.66 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|