About 2-[4-(2-(18F)fluoroethyl)piperidin-1-yl]pyrimido[1,2-a]benzimidazole
2-[4-(2-(18F)fluoroethyl)piperidin-1-yl]pyrimido[1,2-a]benzimidazole (PubChem CID 66563709) has the molecular formula C17H19FN4
and a molecular weight of 297.37 g/mol. Its IUPAC name is 2-[4-(2-(18F)fluoroethyl)piperidin-1-yl]pyrimido[1,2-a]benzimidazole.
Molecular Properties
| Compound Name | 2-[4-(2-(18F)fluoroethyl)piperidin-1-yl]pyrimido[1,2-a]benzimidazole |
| PubChem CID | 66563709 |
| Molecular Formula | C17H19FN4 |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 2-[4-(2-(18F)fluoroethyl)piperidin-1-yl]pyrimido[1,2-a]benzimidazole |
| SMILES | [18F]CCC1CCN(c2ccn3c(n2)nc2ccccc23)CC1 |
| InChI | InChI=1S/C17H19FN4/c18-9-5-13-6-10-21(11-7-13)16-8-12-22-15-4-2-1-3-14(15)19-17(22)20-16/h1-4,8,12-13H,5-7,9-11H2/i18-1 |
| InChIKey | DWSFKWXDRBTTCG-SQZVAGKESA-N |
| XLogP | 3.46 |
| TPSA | 33.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-(2-(18F)fluoroethyl)piperidin-1-yl]pyrimido[1,2-a]benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2-(18F)fluoroethyl)piperidin-1-yl]pyrimido[1,2-a]benzimidazole?
The IUPAC name of 2-[4-(2-(18F)fluoroethyl)piperidin-1-yl]pyrimido[1,2-a]benzimidazole (CID 66563709) is 2-[4-(2-(18F)fluoroethyl)piperidin-1-yl]pyrimido[1,2-a]benzimidazole.
What is the SMILES notation for 2-[4-(2-(18F)fluoroethyl)piperidin-1-yl]pyrimido[1,2-a]benzimidazole?
The canonical SMILES for 2-[4-(2-(18F)fluoroethyl)piperidin-1-yl]pyrimido[1,2-a]benzimidazole is [18F]CCC1CCN(c2ccn3c(n2)nc2ccccc23)CC1.
What is the InChIKey of 2-[4-(2-(18F)fluoroethyl)piperidin-1-yl]pyrimido[1,2-a]benzimidazole?
The InChIKey is DWSFKWXDRBTTCG-SQZVAGKESA-N. The full InChI is InChI=1S/C17H19FN4/c18-9-5-13-6-10-21(11-7-13)16-8-12-22-15-4-2-1-3-14(15)19-17(22)20-16/h1-4,8,12-13H,5-7,9-11H2/i18-1.
What are the key properties of 2-[4-(2-(18F)fluoroethyl)piperidin-1-yl]pyrimido[1,2-a]benzimidazole?
2-[4-(2-(18F)fluoroethyl)piperidin-1-yl]pyrimido[1,2-a]benzimidazole has a molecular weight of 297.37 g/mol, XLogP of 3.46, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2-(18F)fluoroethyl)piperidin-1-yl]pyrimido[1,2-a]benzimidazole is sourced from PubChem (CID 66563709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).