C12H24N2O2S — CID 66564538
tert-butyl 3-(2-aminoethylsulfanylmethyl)pyrrolidine-1-carboxylate (PubChem CID 66564538) has the molecular formula C12H24N2O2S and a molecular weight of 260.40 g/mol. Its IUPAC name is tert-butyl 3-(2-aminoethylsulfanylmethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-(2-aminoethylsulfanylmethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 66564538 |
| Molecular Formula | C12H24N2O2S |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | tert-butyl 3-(2-aminoethylsulfanylmethyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CSCCN)C1 |
| InChI | InChI=1S/C12H24N2O2S/c1-12(2,3)16-11(15)14-6-4-10(8-14)9-17-7-5-13/h10H,4-9,13H2,1-3H3 |
| InChIKey | OYNRIYYXTOECBG-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|