About N'-[(4-methylsulfanylphenyl)methyl]-N'-propan-2-ylethane-1,2-diamine
N'-[(4-methylsulfanylphenyl)methyl]-N'-propan-2-ylethane-1,2-diamine (PubChem CID 66568276) has the molecular formula C13H22N2S
and a molecular weight of 238.40 g/mol. Its IUPAC name is N'-[(4-methylsulfanylphenyl)methyl]-N'-propan-2-ylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-[(4-methylsulfanylphenyl)methyl]-N'-propan-2-ylethane-1,2-diamine |
| PubChem CID | 66568276 |
| Molecular Formula | C13H22N2S |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | N'-[(4-methylsulfanylphenyl)methyl]-N'-propan-2-ylethane-1,2-diamine |
| SMILES | CSc1ccc(CN(CCN)C(C)C)cc1 |
| InChI | InChI=1S/C13H22N2S/c1-11(2)15(9-8-14)10-12-4-6-13(16-3)7-5-12/h4-7,11H,8-10,14H2,1-3H3 |
| InChIKey | CNIBAITVNGXRTL-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N'-[(4-methylsulfanylphenyl)methyl]-N'-propan-2-ylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(4-methylsulfanylphenyl)methyl]-N'-propan-2-ylethane-1,2-diamine?
The IUPAC name of N'-[(4-methylsulfanylphenyl)methyl]-N'-propan-2-ylethane-1,2-diamine (CID 66568276) is N'-[(4-methylsulfanylphenyl)methyl]-N'-propan-2-ylethane-1,2-diamine.
What is the SMILES notation for N'-[(4-methylsulfanylphenyl)methyl]-N'-propan-2-ylethane-1,2-diamine?
The canonical SMILES for N'-[(4-methylsulfanylphenyl)methyl]-N'-propan-2-ylethane-1,2-diamine is CSc1ccc(CN(CCN)C(C)C)cc1.
What is the InChIKey of N'-[(4-methylsulfanylphenyl)methyl]-N'-propan-2-ylethane-1,2-diamine?
The InChIKey is CNIBAITVNGXRTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2S/c1-11(2)15(9-8-14)10-12-4-6-13(16-3)7-5-12/h4-7,11H,8-10,14H2,1-3H3.
What are the key properties of N'-[(4-methylsulfanylphenyl)methyl]-N'-propan-2-ylethane-1,2-diamine?
N'-[(4-methylsulfanylphenyl)methyl]-N'-propan-2-ylethane-1,2-diamine has a molecular weight of 238.40 g/mol, XLogP of 2.58, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(4-methylsulfanylphenyl)methyl]-N'-propan-2-ylethane-1,2-diamine is sourced from PubChem (CID 66568276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).