About N'-[(6-bromo-3-pyridinyl)methyl]-N'-propan-2-ylethane-1,2-diamine
N'-[(6-bromo-3-pyridinyl)methyl]-N'-propan-2-ylethane-1,2-diamine (PubChem CID 66568578) has the molecular formula C11H18BrN3
and a molecular weight of 272.19 g/mol. Its IUPAC name is N'-[(6-bromo-3-pyridinyl)methyl]-N'-propan-2-ylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-[(6-bromo-3-pyridinyl)methyl]-N'-propan-2-ylethane-1,2-diamine |
| PubChem CID | 66568578 |
| Molecular Formula | C11H18BrN3 |
| Molecular Weight | 272.19 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | N'-[(6-bromo-3-pyridinyl)methyl]-N'-propan-2-ylethane-1,2-diamine |
| SMILES | CC(C)N(CCN)Cc1ccc(Br)nc1 |
| InChI | InChI=1S/C11H18BrN3/c1-9(2)15(6-5-13)8-10-3-4-11(12)14-7-10/h3-4,7,9H,5-6,8,13H2,1-2H3 |
| InChIKey | XTOORNRHUWOSDG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.19 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze N'-[(6-bromo-3-pyridinyl)methyl]-N'-propan-2-ylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(6-bromo-3-pyridinyl)methyl]-N'-propan-2-ylethane-1,2-diamine?
The IUPAC name of N'-[(6-bromo-3-pyridinyl)methyl]-N'-propan-2-ylethane-1,2-diamine (CID 66568578) is N'-[(6-bromo-3-pyridinyl)methyl]-N'-propan-2-ylethane-1,2-diamine.
What is the SMILES notation for N'-[(6-bromo-3-pyridinyl)methyl]-N'-propan-2-ylethane-1,2-diamine?
The canonical SMILES for N'-[(6-bromo-3-pyridinyl)methyl]-N'-propan-2-ylethane-1,2-diamine is CC(C)N(CCN)Cc1ccc(Br)nc1.
What is the InChIKey of N'-[(6-bromo-3-pyridinyl)methyl]-N'-propan-2-ylethane-1,2-diamine?
The InChIKey is XTOORNRHUWOSDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18BrN3/c1-9(2)15(6-5-13)8-10-3-4-11(12)14-7-10/h3-4,7,9H,5-6,8,13H2,1-2H3.
What are the key properties of N'-[(6-bromo-3-pyridinyl)methyl]-N'-propan-2-ylethane-1,2-diamine?
N'-[(6-bromo-3-pyridinyl)methyl]-N'-propan-2-ylethane-1,2-diamine has a molecular weight of 272.19 g/mol, XLogP of 2.01, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(6-bromo-3-pyridinyl)methyl]-N'-propan-2-ylethane-1,2-diamine is sourced from PubChem (CID 66568578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).