About N'-[(2-chloro-1,3-thiazol-5-yl)methyl]-N'-propan-2-ylethane-1,2-diamine
N'-[(2-chloro-1,3-thiazol-5-yl)methyl]-N'-propan-2-ylethane-1,2-diamine (PubChem CID 66568672) has the molecular formula C9H16ClN3S
and a molecular weight of 233.77 g/mol. Its IUPAC name is N'-[(2-chloro-1,3-thiazol-5-yl)methyl]-N'-propan-2-ylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-[(2-chloro-1,3-thiazol-5-yl)methyl]-N'-propan-2-ylethane-1,2-diamine |
| PubChem CID | 66568672 |
| Molecular Formula | C9H16ClN3S |
| Molecular Weight | 233.77 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | N'-[(2-chloro-1,3-thiazol-5-yl)methyl]-N'-propan-2-ylethane-1,2-diamine |
| SMILES | CC(C)N(CCN)Cc1cnc(Cl)s1 |
| InChI | InChI=1S/C9H16ClN3S/c1-7(2)13(4-3-11)6-8-5-12-9(10)14-8/h5,7H,3-4,6,11H2,1-2H3 |
| InChIKey | CFGCYIYOSAQVPK-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.77 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N'-[(2-chloro-1,3-thiazol-5-yl)methyl]-N'-propan-2-ylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(2-chloro-1,3-thiazol-5-yl)methyl]-N'-propan-2-ylethane-1,2-diamine?
The IUPAC name of N'-[(2-chloro-1,3-thiazol-5-yl)methyl]-N'-propan-2-ylethane-1,2-diamine (CID 66568672) is N'-[(2-chloro-1,3-thiazol-5-yl)methyl]-N'-propan-2-ylethane-1,2-diamine.
What is the SMILES notation for N'-[(2-chloro-1,3-thiazol-5-yl)methyl]-N'-propan-2-ylethane-1,2-diamine?
The canonical SMILES for N'-[(2-chloro-1,3-thiazol-5-yl)methyl]-N'-propan-2-ylethane-1,2-diamine is CC(C)N(CCN)Cc1cnc(Cl)s1.
What is the InChIKey of N'-[(2-chloro-1,3-thiazol-5-yl)methyl]-N'-propan-2-ylethane-1,2-diamine?
The InChIKey is CFGCYIYOSAQVPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16ClN3S/c1-7(2)13(4-3-11)6-8-5-12-9(10)14-8/h5,7H,3-4,6,11H2,1-2H3.
What are the key properties of N'-[(2-chloro-1,3-thiazol-5-yl)methyl]-N'-propan-2-ylethane-1,2-diamine?
N'-[(2-chloro-1,3-thiazol-5-yl)methyl]-N'-propan-2-ylethane-1,2-diamine has a molecular weight of 233.77 g/mol, XLogP of 1.97, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(2-chloro-1,3-thiazol-5-yl)methyl]-N'-propan-2-ylethane-1,2-diamine is sourced from PubChem (CID 66568672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).