About 4-chloro-5-methoxy-N,N-dimethylpyrimidin-2-amine
4-chloro-5-methoxy-N,N-dimethylpyrimidin-2-amine (PubChem CID 66569543) has the molecular formula C7H10ClN3O
and a molecular weight of 187.63 g/mol. Its IUPAC name is 4-chloro-5-methoxy-N,N-dimethylpyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-chloro-5-methoxy-N,N-dimethylpyrimidin-2-amine |
| PubChem CID | 66569543 |
| Molecular Formula | C7H10ClN3O |
| Molecular Weight | 187.63 g/mol |
| Exact Mass | 187.05 |
| IUPAC Name | 4-chloro-5-methoxy-N,N-dimethylpyrimidin-2-amine |
| SMILES | COc1cnc(N(C)C)nc1Cl |
| InChI | InChI=1S/C7H10ClN3O/c1-11(2)7-9-4-5(12-3)6(8)10-7/h4H,1-3H3 |
| InChIKey | YCYQCEBMTBCORO-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.63 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-chloro-5-methoxy-N,N-dimethylpyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-5-methoxy-N,N-dimethylpyrimidin-2-amine?
The IUPAC name of 4-chloro-5-methoxy-N,N-dimethylpyrimidin-2-amine (CID 66569543) is 4-chloro-5-methoxy-N,N-dimethylpyrimidin-2-amine.
What is the SMILES notation for 4-chloro-5-methoxy-N,N-dimethylpyrimidin-2-amine?
The canonical SMILES for 4-chloro-5-methoxy-N,N-dimethylpyrimidin-2-amine is COc1cnc(N(C)C)nc1Cl.
What is the InChIKey of 4-chloro-5-methoxy-N,N-dimethylpyrimidin-2-amine?
The InChIKey is YCYQCEBMTBCORO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10ClN3O/c1-11(2)7-9-4-5(12-3)6(8)10-7/h4H,1-3H3.
What are the key properties of 4-chloro-5-methoxy-N,N-dimethylpyrimidin-2-amine?
4-chloro-5-methoxy-N,N-dimethylpyrimidin-2-amine has a molecular weight of 187.63 g/mol, XLogP of 1.20, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-5-methoxy-N,N-dimethylpyrimidin-2-amine is sourced from PubChem (CID 66569543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).