About (2S)-1,1,1-trifluoro-2-[methyl(sulfamoyl)amino]propane
(2S)-1,1,1-trifluoro-2-[methyl(sulfamoyl)amino]propane (PubChem CID 66570563) has the molecular formula C4H9F3N2O2S
and a molecular weight of 206.19 g/mol. Its IUPAC name is (2S)-1,1,1-trifluoro-2-[methyl(sulfamoyl)amino]propane.
Molecular Properties
| Compound Name | (2S)-1,1,1-trifluoro-2-[methyl(sulfamoyl)amino]propane |
| PubChem CID | 66570563 |
| Molecular Formula | C4H9F3N2O2S |
| Molecular Weight | 206.19 g/mol |
| Exact Mass | 206.03 |
| IUPAC Name | (2S)-1,1,1-trifluoro-2-[methyl(sulfamoyl)amino]propane |
| SMILES | C[C@H](N(C)S(N)(=O)=O)C(F)(F)F |
| InChI | InChI=1S/C4H9F3N2O2S/c1-3(4(5,6)7)9(2)12(8,10)11/h3H,1-2H3,(H2,8,10,11)/t3-/m0/s1 |
| InChIKey | PUSUXZZTNUXPQJ-VKHMYHEASA-N |
| XLogP | 0.07 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.19 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-1,1,1-trifluoro-2-[methyl(sulfamoyl)amino]propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1,1,1-trifluoro-2-[methyl(sulfamoyl)amino]propane?
The IUPAC name of (2S)-1,1,1-trifluoro-2-[methyl(sulfamoyl)amino]propane (CID 66570563) is (2S)-1,1,1-trifluoro-2-[methyl(sulfamoyl)amino]propane.
What is the SMILES notation for (2S)-1,1,1-trifluoro-2-[methyl(sulfamoyl)amino]propane?
The canonical SMILES for (2S)-1,1,1-trifluoro-2-[methyl(sulfamoyl)amino]propane is C[C@H](N(C)S(N)(=O)=O)C(F)(F)F.
What is the InChIKey of (2S)-1,1,1-trifluoro-2-[methyl(sulfamoyl)amino]propane?
The InChIKey is PUSUXZZTNUXPQJ-VKHMYHEASA-N. The full InChI is InChI=1S/C4H9F3N2O2S/c1-3(4(5,6)7)9(2)12(8,10)11/h3H,1-2H3,(H2,8,10,11)/t3-/m0/s1.
What are the key properties of (2S)-1,1,1-trifluoro-2-[methyl(sulfamoyl)amino]propane?
(2S)-1,1,1-trifluoro-2-[methyl(sulfamoyl)amino]propane has a molecular weight of 206.19 g/mol, XLogP of 0.07, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1,1,1-trifluoro-2-[methyl(sulfamoyl)amino]propane is sourced from PubChem (CID 66570563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).