C19H21BCl2O2 — CID 66570718
2-[2-(3,4-dichloro-5-methylphenyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 66570718) has the molecular formula C19H21BCl2O2 and a molecular weight of 363.09 g/mol. Its IUPAC name is 2-[2-(3,4-dichloro-5-methylphenyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[2-(3,4-dichloro-5-methylphenyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 66570718 |
| Molecular Formula | C19H21BCl2O2 |
| Molecular Weight | 363.09 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 2-[2-(3,4-dichloro-5-methylphenyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | Cc1cc(-c2ccccc2B2OC(C)(C)C(C)(C)O2)cc(Cl)c1Cl |
| InChI | InChI=1S/C19H21BCl2O2/c1-12-10-13(11-16(21)17(12)22)14-8-6-7-9-15(14)20-23-18(2,3)19(4,5)24-20/h6-11H,1-5H3 |
| InChIKey | CIJNWHIHKCEGDO-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.09 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|