About 6-bromo-3-(oxan-4-yl)-[1,2,4]triazolo[4,3-a]pyridine
6-bromo-3-(oxan-4-yl)-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 66570785) has the molecular formula C11H12BrN3O
and a molecular weight of 282.14 g/mol. Its IUPAC name is 6-bromo-3-(oxan-4-yl)-[1,2,4]triazolo[4,3-a]pyridine.
Molecular Properties
| Compound Name | 6-bromo-3-(oxan-4-yl)-[1,2,4]triazolo[4,3-a]pyridine |
| PubChem CID | 66570785 |
| Molecular Formula | C11H12BrN3O |
| Molecular Weight | 282.14 g/mol |
| Exact Mass | 281.02 |
| IUPAC Name | 6-bromo-3-(oxan-4-yl)-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | Brc1ccc2nnc(C3CCOCC3)n2c1 |
| InChI | InChI=1S/C11H12BrN3O/c12-9-1-2-10-13-14-11(15(10)7-9)8-3-5-16-6-4-8/h1-2,7-8H,3-6H2 |
| InChIKey | WAYWTOVREFZLGG-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.14 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-bromo-3-(oxan-4-yl)-[1,2,4]triazolo[4,3-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-3-(oxan-4-yl)-[1,2,4]triazolo[4,3-a]pyridine?
The IUPAC name of 6-bromo-3-(oxan-4-yl)-[1,2,4]triazolo[4,3-a]pyridine (CID 66570785) is 6-bromo-3-(oxan-4-yl)-[1,2,4]triazolo[4,3-a]pyridine.
What is the SMILES notation for 6-bromo-3-(oxan-4-yl)-[1,2,4]triazolo[4,3-a]pyridine?
The canonical SMILES for 6-bromo-3-(oxan-4-yl)-[1,2,4]triazolo[4,3-a]pyridine is Brc1ccc2nnc(C3CCOCC3)n2c1.
What is the InChIKey of 6-bromo-3-(oxan-4-yl)-[1,2,4]triazolo[4,3-a]pyridine?
The InChIKey is WAYWTOVREFZLGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12BrN3O/c12-9-1-2-10-13-14-11(15(10)7-9)8-3-5-16-6-4-8/h1-2,7-8H,3-6H2.
What are the key properties of 6-bromo-3-(oxan-4-yl)-[1,2,4]triazolo[4,3-a]pyridine?
6-bromo-3-(oxan-4-yl)-[1,2,4]triazolo[4,3-a]pyridine has a molecular weight of 282.14 g/mol, XLogP of 2.39, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-3-(oxan-4-yl)-[1,2,4]triazolo[4,3-a]pyridine is sourced from PubChem (CID 66570785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).