C23H20ClN5O — CID 66571255
5-(2-aminopyrimidin-4-yl)-N-benzyl-2-(5-chloro-2-methylphenyl)-1H-pyrrole-3-carboxamide (PubChem CID 66571255) has the molecular formula C23H20ClN5O and a molecular weight of 417.90 g/mol. Its IUPAC name is 5-(2-aminopyrimidin-4-yl)-N-benzyl-2-(5-chloro-2-methylphenyl)-1H-pyrrole-3-carboxamide.
| Compound Name | 5-(2-aminopyrimidin-4-yl)-N-benzyl-2-(5-chloro-2-methylphenyl)-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 66571255 |
| Molecular Formula | C23H20ClN5O |
| Molecular Weight | 417.90 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 5-(2-aminopyrimidin-4-yl)-N-benzyl-2-(5-chloro-2-methylphenyl)-1H-pyrrole-3-carboxamide |
| SMILES | Cc1ccc(Cl)cc1-c1[nH]c(-c2ccnc(N)n2)cc1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C23H20ClN5O/c1-14-7-8-16(24)11-17(14)21-18(22(30)27-13-15-5-3-2-4-6-15)12-20(28-21)19-9-10-26-23(25)29-19/h2-12,28H,13H2,1H3,(H,27,30)(H2,25,26,29) |
| InChIKey | STEACKYPSKNGJJ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.90 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |