C29H33F2N2+ — CID 66571361
trans-(1R,2S)-N-[[1,1-bis[(3-fluorophenyl)methyl]piperidin-1-ium-4-yl]methyl]-2-phenylcyclopropan-1-amine (PubChem CID 66571361) has the molecular formula C29H33F2N2+ and a molecular weight of 447.59 g/mol. Its IUPAC name is trans-(1R,2S)-N-[[1,1-bis[(3-fluorophenyl)methyl]piperidin-1-ium-4-yl]methyl]-2-phenylcyclopropan-1-amine.
| Compound Name | trans-(1R,2S)-N-[[1,1-bis[(3-fluorophenyl)methyl]piperidin-1-ium-4-yl]methyl]-2-phenylcyclopropan-1-amine |
|---|---|
| PubChem CID | 66571361 |
| Molecular Formula | C29H33F2N2+ |
| Molecular Weight | 447.59 g/mol |
| Exact Mass | 447.26 |
| IUPAC Name | trans-(1R,2S)-N-[[1,1-bis[(3-fluorophenyl)methyl]piperidin-1-ium-4-yl]methyl]-2-phenylcyclopropan-1-amine |
| SMILES | Fc1cccc(C[N+]2(Cc3cccc(F)c3)CCC(CN[C@@H]3C[C@H]3c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C29H33F2N2/c30-26-10-4-6-23(16-26)20-33(21-24-7-5-11-27(31)17-24)14-12-22(13-15-33)19-32-29-18-28(29)25-8-2-1-3-9-25/h1-11,16-17,22,28-29,32H,12-15,18-21H2/q+1/t28-,29+/m0/s1 |
| InChIKey | RIGBERDVXHOMRF-URLMMPGGSA-N |
| XLogP | 6.04 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.59 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|