C25H24FN5O2S2 — CID 66571554
(5Z)-5-[[2-[4-[[(2-fluoro-6-thiophen-3-ylphenyl)methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 66571554) has the molecular formula C25H24FN5O2S2 and a molecular weight of 509.63 g/mol. Its IUPAC name is (5Z)-5-[[2-[4-[[(2-fluoro-6-thiophen-3-ylphenyl)methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[2-[4-[[(2-fluoro-6-thiophen-3-ylphenyl)methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 66571554 |
| Molecular Formula | C25H24FN5O2S2 |
| Molecular Weight | 509.63 g/mol |
| Exact Mass | 509.14 |
| IUPAC Name | (5Z)-5-[[2-[4-[[(2-fluoro-6-thiophen-3-ylphenyl)methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2ccnc(N3CCC(CNCc4c(F)cccc4-c4ccsc4)CC3)n2)S1 |
| InChI | InChI=1S/C25H24FN5O2S2/c26-21-3-1-2-19(17-7-11-34-15-17)20(21)14-27-13-16-5-9-31(10-6-16)24-28-8-4-18(29-24)12-22-23(32)30-25(33)35-22/h1-4,7-8,11-12,15-16,27H,5-6,9-10,13-14H2,(H,30,32,33)/b22-12- |
| InChIKey | ZNEMQQHBAYAOMW-UUYOSTAYSA-N |
| XLogP | 4.67 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.63 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|