C21H16N4O4S2 — CID 66572266
3-[3-[(4-methylsulfonylphenyl)methyl]-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl]chromen-2-one (PubChem CID 66572266) has the molecular formula C21H16N4O4S2 and a molecular weight of 452.52 g/mol. Its IUPAC name is 3-[3-[(4-methylsulfonylphenyl)methyl]-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl]chromen-2-one.
| Compound Name | 3-[3-[(4-methylsulfonylphenyl)methyl]-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl]chromen-2-one |
|---|---|
| PubChem CID | 66572266 |
| Molecular Formula | C21H16N4O4S2 |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | 3-[3-[(4-methylsulfonylphenyl)methyl]-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl]chromen-2-one |
| SMILES | CS(=O)(=O)c1ccc(Cc2nnc3n2N=C(c2cc4ccccc4oc2=O)CS3)cc1 |
| InChI | InChI=1S/C21H16N4O4S2/c1-31(27,28)15-8-6-13(7-9-15)10-19-22-23-21-25(19)24-17(12-30-21)16-11-14-4-2-3-5-18(14)29-20(16)26/h2-9,11H,10,12H2,1H3 |
| InChIKey | JEQBXNNLKGGSSK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 107.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|