About 4-[1-(2-aminoethylsulfanyl)-1,2-diphenylethyl]phenol
4-[1-(2-aminoethylsulfanyl)-1,2-diphenylethyl]phenol (PubChem CID 66572344) has the molecular formula C22H23NOS
and a molecular weight of 349.50 g/mol. Its IUPAC name is 4-[1-(2-aminoethylsulfanyl)-1,2-diphenylethyl]phenol.
Molecular Properties
| Compound Name | 4-[1-(2-aminoethylsulfanyl)-1,2-diphenylethyl]phenol |
| PubChem CID | 66572344 |
| Molecular Formula | C22H23NOS |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 4-[1-(2-aminoethylsulfanyl)-1,2-diphenylethyl]phenol |
| SMILES | NCCSC(Cc1ccccc1)(c1ccccc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C22H23NOS/c23-15-16-25-22(19-9-5-2-6-10-19,17-18-7-3-1-4-8-18)20-11-13-21(24)14-12-20/h1-14,24H,15-17,23H2 |
| InChIKey | CFENRMXBRFSGKL-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[1-(2-aminoethylsulfanyl)-1,2-diphenylethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(2-aminoethylsulfanyl)-1,2-diphenylethyl]phenol?
The IUPAC name of 4-[1-(2-aminoethylsulfanyl)-1,2-diphenylethyl]phenol (CID 66572344) is 4-[1-(2-aminoethylsulfanyl)-1,2-diphenylethyl]phenol.
What is the SMILES notation for 4-[1-(2-aminoethylsulfanyl)-1,2-diphenylethyl]phenol?
The canonical SMILES for 4-[1-(2-aminoethylsulfanyl)-1,2-diphenylethyl]phenol is NCCSC(Cc1ccccc1)(c1ccccc1)c1ccc(O)cc1.
What is the InChIKey of 4-[1-(2-aminoethylsulfanyl)-1,2-diphenylethyl]phenol?
The InChIKey is CFENRMXBRFSGKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23NOS/c23-15-16-25-22(19-9-5-2-6-10-19,17-18-7-3-1-4-8-18)20-11-13-21(24)14-12-20/h1-14,24H,15-17,23H2.
What are the key properties of 4-[1-(2-aminoethylsulfanyl)-1,2-diphenylethyl]phenol?
4-[1-(2-aminoethylsulfanyl)-1,2-diphenylethyl]phenol has a molecular weight of 349.50 g/mol, XLogP of 4.57, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(2-aminoethylsulfanyl)-1,2-diphenylethyl]phenol is sourced from PubChem (CID 66572344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).